4-(4-methylphenoxy)benzoic acid
Catalog No: FT-0759977
CAS No: 21120-65-0
- Chemical Name: 4-(4-methylphenoxy)benzoic acid
- Molecular Formula: C14H12O3
- Molecular Weight: 228.24
- InChI Key: DCDYPMNXCDXNJZ-UHFFFAOYSA-N
- InChI: InChI=1S/C14H12O3/c1-10-2-6-12(7-3-10)17-13-8-4-11(5-9-13)14(15)16/h2-9H,1H3,(H,15,16)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS09 |
|---|---|
| CAS: | 21120-65-0 |
| Flash_Point: | 142.8ºC |
| Product_Name: | 4-(4-methylphenoxy)benzoic acid |
| Bolling_Point: | 375.3ºC at 760mmHg |
| FW: | 228.24300 |
| Melting_Point: | 178-182ºC |
| MF: | C14H12O3 |
| Density: | 1.208g/cm3 |
| Melting_Point: | 178-182ºC |
|---|---|
| FW: | 228.24300 |
| Refractive_Index: | 1.598 |
| Vapor_Pressure: | 2.68E-06mmHg at 25°C |
| MF: | C14H12O3 |
| Exact_Mass: | 228.07900 |
| LogP: | 3.48550 |
| Bolling_Point: | 375.3ºC at 760mmHg |
| Density: | 1.208g/cm3 |
| PSA: | 46.53000 |
| Flash_Point: | 142.8ºC |
| Symbol: | GHS07, GHS09 |
|---|---|
| Risk_Statements(EU): | R22 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | UN 3077 9 / PGIII |
| HS_Code: | 2918990090 |
| Hazard_Codes: | Xn: Harmful;N: Dangerous for the environment; |
| Warning_Statement: | P273-P305 + P351 + P338 |
| Safety_Statements: | H302-H319-H400 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)